C9H10FN — CID 144848748
N-[(3Z)-2-fluoroocta-1,3-dien-5-yn-4-yl]methanimine (PubChem CID 144848748) has the molecular formula C9H10FN and a molecular weight of 151.18 g/mol. Its IUPAC name is N-[(3Z)-2-fluoroocta-1,3-dien-5-yn-4-yl]methanimine.
| Compound Name | N-[(3Z)-2-fluoroocta-1,3-dien-5-yn-4-yl]methanimine |
|---|---|
| PubChem CID | 144848748 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | N-[(3Z)-2-fluoroocta-1,3-dien-5-yn-4-yl]methanimine |
| SMILES | C=N/C(C#CCC)=C\C(=C)F |
| InChI | InChI=1S/C9H10FN/c1-4-5-6-9(11-3)7-8(2)10/h7H,2-4H2,1H3/b9-7- |
| InChIKey | UVJXYSCDCOYAEI-CLFYSBASSA-N |
| XLogP | 2.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|