C23H19F5O4 — CID 130362678
(2,3,4,5,6-pentafluorophenyl) 2-[2-methoxy-4-oxo-3-(2,4,6-trimethylphenyl)cyclopent-2-en-1-yl]acetate (PubChem CID 130362678) has the molecular formula C23H19F5O4 and a molecular weight of 454.39 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-[2-methoxy-4-oxo-3-(2,4,6-trimethylphenyl)cyclopent-2-en-1-yl]acetate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-[2-methoxy-4-oxo-3-(2,4,6-trimethylphenyl)cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 130362678 |
| Molecular Formula | C23H19F5O4 |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-[2-methoxy-4-oxo-3-(2,4,6-trimethylphenyl)cyclopent-2-en-1-yl]acetate |
| SMILES | COC1=C(c2c(C)cc(C)cc2C)C(=O)CC1CC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C23H19F5O4/c1-9-5-10(2)15(11(3)6-9)16-13(29)7-12(22(16)31-4)8-14(30)32-23-20(27)18(25)17(24)19(26)21(23)28/h5-6,12H,7-8H2,1-4H3 |
| InChIKey | RYMUCSVAXQKGSK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|