C28H34N8O2 — CID 130363443
1-[(2S,6R)-4-[3-[4-amino-5-[2-(oxan-4-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-2,6-dimethylpiperazin-1-yl]ethanone (PubChem CID 130363443) has the molecular formula C28H34N8O2 and a molecular weight of 514.63 g/mol. Its IUPAC name is 1-[(2S,6R)-4-[3-[4-amino-5-[2-(oxan-4-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-2,6-dimethylpiperazin-1-yl]ethanone.
| Compound Name | 1-[(2S,6R)-4-[3-[4-amino-5-[2-(oxan-4-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-2,6-dimethylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 130363443 |
| Molecular Formula | C28H34N8O2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | 1-[(2S,6R)-4-[3-[4-amino-5-[2-(oxan-4-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-2,6-dimethylpiperazin-1-yl]ethanone |
| SMILES | CC(=O)N1[C@H](C)CN(c2cccc(-c3cc(-c4ccnn4C4CCOCC4)c4c(N)ncnn34)c2)C[C@@H]1C |
| InChI | InChI=1S/C28H34N8O2/c1-18-15-33(16-19(2)34(18)20(3)37)23-6-4-5-21(13-23)26-14-24(27-28(29)30-17-32-36(26)27)25-7-10-31-35(25)22-8-11-38-12-9-22/h4-7,10,13-14,17-19,22H,8-9,11-12,15-16H2,1-3H3,(H2,29,30,32)/t18-,19+ |
| InChIKey | POOPPUSEMPNZPC-KDURUIRLSA-N |
| XLogP | 3.64 |
| TPSA | 106.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |