C21H22N8O — CID 130363579
3-[4-amino-5-[2-(oxan-4-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzenecarboximidamide (PubChem CID 130363579) has the molecular formula C21H22N8O and a molecular weight of 402.46 g/mol. Its IUPAC name is 3-[4-amino-5-[2-(oxan-4-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzenecarboximidamide.
| Compound Name | 3-[4-amino-5-[2-(oxan-4-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 130363579 |
| Molecular Formula | C21H22N8O |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 3-[4-amino-5-[2-(oxan-4-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(-c2cc(-c3ccnn3C3CCOCC3)c3c(N)ncnn23)c1 |
| InChI | InChI=1S/C21H22N8O/c22-20(23)14-3-1-2-13(10-14)18-11-16(19-21(24)25-12-27-29(18)19)17-4-7-26-28(17)15-5-8-30-9-6-15/h1-4,7,10-12,15H,5-6,8-9H2,(H3,22,23)(H2,24,25,27) |
| InChIKey | UKMUGEJEJIRPMZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|