C23H27N7O2S — CID 146590489
4-amino-5-(2-cyclohexylpyrazol-3-yl)-7-[3-[2-(sulfinoamino)ethyl]phenyl]pyrrolo[2,1-f][1,2,4]triazine (PubChem CID 146590489) has the molecular formula C23H27N7O2S and a molecular weight of 465.58 g/mol. Its IUPAC name is 4-amino-5-(2-cyclohexylpyrazol-3-yl)-7-[3-[2-(sulfinoamino)ethyl]phenyl]pyrrolo[2,1-f][1,2,4]triazine.
| Compound Name | 4-amino-5-(2-cyclohexylpyrazol-3-yl)-7-[3-[2-(sulfinoamino)ethyl]phenyl]pyrrolo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 146590489 |
| Molecular Formula | C23H27N7O2S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 4-amino-5-(2-cyclohexylpyrazol-3-yl)-7-[3-[2-(sulfinoamino)ethyl]phenyl]pyrrolo[2,1-f][1,2,4]triazine |
| SMILES | Nc1ncnn2c(-c3cccc(CCNS(=O)O)c3)cc(-c3ccnn3C3CCCCC3)c12 |
| InChI | InChI=1S/C23H27N7O2S/c24-23-22-19(20-10-11-26-29(20)18-7-2-1-3-8-18)14-21(30(22)27-15-25-23)17-6-4-5-16(13-17)9-12-28-33(31)32/h4-6,10-11,13-15,18,28H,1-3,7-9,12H2,(H,31,32)(H2,24,25,27) |
| InChIKey | LGGYGEXVODTXQX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 123.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|