C14H32N2O — CID 130365569
N'-octoxy-N'-propylpropane-1,3-diamine (PubChem CID 130365569) has the molecular formula C14H32N2O and a molecular weight of 244.42 g/mol. Its IUPAC name is N'-octoxy-N'-propylpropane-1,3-diamine.
| Compound Name | N'-octoxy-N'-propylpropane-1,3-diamine |
|---|---|
| PubChem CID | 130365569 |
| Molecular Formula | C14H32N2O |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.25 |
| IUPAC Name | N'-octoxy-N'-propylpropane-1,3-diamine |
| SMILES | CCCCCCCCON(CCC)CCCN |
| InChI | InChI=1S/C14H32N2O/c1-3-5-6-7-8-9-14-17-16(12-4-2)13-10-11-15/h3-15H2,1-2H3 |
| InChIKey | ZXIIUSUGMKTYAO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|