C10H10O6 — CID 130365654
5,7-dioxospiro[2.5]octane-6,8-dicarboxylic acid (PubChem CID 130365654) has the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. Its IUPAC name is 5,7-dioxospiro[2.5]octane-6,8-dicarboxylic acid.
| Compound Name | 5,7-dioxospiro[2.5]octane-6,8-dicarboxylic acid |
|---|---|
| PubChem CID | 130365654 |
| Molecular Formula | C10H10O6 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 5,7-dioxospiro[2.5]octane-6,8-dicarboxylic acid |
| SMILES | O=C(O)C1C(=O)CC2(CC2)C(C(=O)O)C1=O |
| InChI | InChI=1S/C10H10O6/c11-4-3-10(1-2-10)6(9(15)16)7(12)5(4)8(13)14/h5-6H,1-3H2,(H,13,14)(H,15,16) |
| InChIKey | XFGMOSPTTAXRPB-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|