C9H19NO4S — CID 130367311
(2S)-6-(2-methoxyethoxy)hex-5-ene-2-sulfonamide (PubChem CID 130367311) has the molecular formula C9H19NO4S and a molecular weight of 237.32 g/mol. Its IUPAC name is (2S)-6-(2-methoxyethoxy)hex-5-ene-2-sulfonamide.
| Compound Name | (2S)-6-(2-methoxyethoxy)hex-5-ene-2-sulfonamide |
|---|---|
| PubChem CID | 130367311 |
| Molecular Formula | C9H19NO4S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (2S)-6-(2-methoxyethoxy)hex-5-ene-2-sulfonamide |
| SMILES | COCCOC=CCC[C@H](C)S(N)(=O)=O |
| InChI | InChI=1S/C9H19NO4S/c1-9(15(10,11)12)5-3-4-6-14-8-7-13-2/h4,6,9H,3,5,7-8H2,1-2H3,(H2,10,11,12)/t9-/m0/s1 |
| InChIKey | RMZQQPCQSJWIAM-VIFPVBQESA-N |
| XLogP | 0.62 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|