C13H26O4 — CID 162392404
1-(methoxymethoxy)-5,5-dipropoxypent-1-ene (PubChem CID 162392404) has the molecular formula C13H26O4 and a molecular weight of 246.35 g/mol. Its IUPAC name is 1-(methoxymethoxy)-5,5-dipropoxypent-1-ene.
| Compound Name | 1-(methoxymethoxy)-5,5-dipropoxypent-1-ene |
|---|---|
| PubChem CID | 162392404 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 1-(methoxymethoxy)-5,5-dipropoxypent-1-ene |
| SMILES | CCCOC(CCC=COCOC)OCCC |
| InChI | InChI=1S/C13H26O4/c1-4-9-16-13(17-10-5-2)8-6-7-11-15-12-14-3/h7,11,13H,4-6,8-10,12H2,1-3H3 |
| InChIKey | UPDKGOBSBQTDAC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|