C11H21NO — CID 130367474
(3R,4S)-1-tert-butyl-4-prop-2-enylpyrrolidin-3-ol (PubChem CID 130367474) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (3R,4S)-1-tert-butyl-4-prop-2-enylpyrrolidin-3-ol.
| Compound Name | (3R,4S)-1-tert-butyl-4-prop-2-enylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 130367474 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (3R,4S)-1-tert-butyl-4-prop-2-enylpyrrolidin-3-ol |
| SMILES | C=CC[C@H]1CN(C(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C11H21NO/c1-5-6-9-7-12(8-10(9)13)11(2,3)4/h5,9-10,13H,1,6-8H2,2-4H3/t9-,10-/m0/s1 |
| InChIKey | LQFORTBJYQUAGR-UWVGGRQHSA-N |
| XLogP | 1.65 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|