C12H23NO — CID 157238919
(3R)-1-[(4R)-4,5-dimethylhex-1-en-3-yl]pyrrolidin-3-ol (PubChem CID 157238919) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (3R)-1-[(4R)-4,5-dimethylhex-1-en-3-yl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[(4R)-4,5-dimethylhex-1-en-3-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 157238919 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (3R)-1-[(4R)-4,5-dimethylhex-1-en-3-yl]pyrrolidin-3-ol |
| SMILES | C=CC([C@H](C)C(C)C)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C12H23NO/c1-5-12(10(4)9(2)3)13-7-6-11(14)8-13/h5,9-12,14H,1,6-8H2,2-4H3/t10-,11-,12?/m1/s1 |
| InChIKey | AUYYUGIUZMSPSK-XFKKCKKNSA-N |
| XLogP | 1.90 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|