C15H20N2O3 — CID 130368818
ethyl 4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 130368818) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is ethyl 4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 130368818 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | ethyl 4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | C=C(/C=C\C=C/C)C1NC(=O)NC(C)=C1C(=O)OCC |
| InChI | InChI=1S/C15H20N2O3/c1-5-7-8-9-10(3)13-12(14(18)20-6-2)11(4)16-15(19)17-13/h5,7-9,13H,3,6H2,1-2,4H3,(H2,16,17,19)/b7-5-,9-8- |
| InChIKey | AUOHZJRFGPWORG-PJHABFGRSA-N |
| XLogP | 2.19 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|