C24H31F3N2O4 — CID 130369491
(1R,2R)-2-[[1-hydroxy-3-(4-methoxyphenoxy)propyl]amino]-3-pyrrolidin-1-yl-1-[4-(trifluoromethyl)phenyl]propan-1-ol (PubChem CID 130369491) has the molecular formula C24H31F3N2O4 and a molecular weight of 468.52 g/mol. Its IUPAC name is (1R,2R)-2-[[1-hydroxy-3-(4-methoxyphenoxy)propyl]amino]-3-pyrrolidin-1-yl-1-[4-(trifluoromethyl)phenyl]propan-1-ol.
| Compound Name | (1R,2R)-2-[[1-hydroxy-3-(4-methoxyphenoxy)propyl]amino]-3-pyrrolidin-1-yl-1-[4-(trifluoromethyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 130369491 |
| Molecular Formula | C24H31F3N2O4 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | (1R,2R)-2-[[1-hydroxy-3-(4-methoxyphenoxy)propyl]amino]-3-pyrrolidin-1-yl-1-[4-(trifluoromethyl)phenyl]propan-1-ol |
| SMILES | COc1ccc(OCCC(O)N[C@H](CN2CCCC2)[C@H](O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H31F3N2O4/c1-32-19-8-10-20(11-9-19)33-15-12-22(30)28-21(16-29-13-2-3-14-29)23(31)17-4-6-18(7-5-17)24(25,26)27/h4-11,21-23,28,30-31H,2-3,12-16H2,1H3/t21-,22?,23-/m1/s1 |
| InChIKey | KYSNPYGHBSMACB-OJVMETQDSA-N |
| XLogP | 3.59 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|