C35H44N2O6 — CID 59531004
N-[(1R,2R)-1-hydroxy-1-[4-(3-phenoxypropoxy)phenyl]-3-pyrrolidin-1-ylpropan-2-yl]-6-(4-methoxyphenyl)-6-oxohexanamide (PubChem CID 59531004) has the molecular formula C35H44N2O6 and a molecular weight of 588.75 g/mol. Its IUPAC name is N-[(1R,2R)-1-hydroxy-1-[4-(3-phenoxypropoxy)phenyl]-3-pyrrolidin-1-ylpropan-2-yl]-6-(4-methoxyphenyl)-6-oxohexanamide.
| Compound Name | N-[(1R,2R)-1-hydroxy-1-[4-(3-phenoxypropoxy)phenyl]-3-pyrrolidin-1-ylpropan-2-yl]-6-(4-methoxyphenyl)-6-oxohexanamide |
|---|---|
| PubChem CID | 59531004 |
| Molecular Formula | C35H44N2O6 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.32 |
| IUPAC Name | N-[(1R,2R)-1-hydroxy-1-[4-(3-phenoxypropoxy)phenyl]-3-pyrrolidin-1-ylpropan-2-yl]-6-(4-methoxyphenyl)-6-oxohexanamide |
| SMILES | COc1ccc(C(=O)CCCCC(=O)N[C@H](CN2CCCC2)[C@H](O)c2ccc(OCCCOc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C35H44N2O6/c1-41-29-18-14-27(15-19-29)33(38)12-5-6-13-34(39)36-32(26-37-22-7-8-23-37)35(40)28-16-20-31(21-17-28)43-25-9-24-42-30-10-3-2-4-11-30/h2-4,10-11,14-21,32,35,40H,5-9,12-13,22-26H2,1H3,(H,36,39)/t32-,35-/m1/s1 |
| InChIKey | IQTNPEQOMUDGMN-FHPVIJFVSA-N |
| XLogP | 5.60 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|