C38H48FNO6 — CID 91303350
11-[4-[3-(4-fluorophenoxy)propoxy]phenyl]-11-hydroxy-1-(4-methoxyphenyl)-10-(pyrrolidin-1-ylmethyl)undecane-1,6-dione (PubChem CID 91303350) has the molecular formula C38H48FNO6 and a molecular weight of 633.80 g/mol. Its IUPAC name is 11-[4-[3-(4-fluorophenoxy)propoxy]phenyl]-11-hydroxy-1-(4-methoxyphenyl)-10-(pyrrolidin-1-ylmethyl)undecane-1,6-dione.
| Compound Name | 11-[4-[3-(4-fluorophenoxy)propoxy]phenyl]-11-hydroxy-1-(4-methoxyphenyl)-10-(pyrrolidin-1-ylmethyl)undecane-1,6-dione |
|---|---|
| PubChem CID | 91303350 |
| Molecular Formula | C38H48FNO6 |
| Molecular Weight | 633.80 g/mol |
| Exact Mass | 633.35 |
| IUPAC Name | 11-[4-[3-(4-fluorophenoxy)propoxy]phenyl]-11-hydroxy-1-(4-methoxyphenyl)-10-(pyrrolidin-1-ylmethyl)undecane-1,6-dione |
| SMILES | COc1ccc(C(=O)CCCCC(=O)CCCC(CN2CCCC2)C(O)c2ccc(OCCCOc3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H48FNO6/c1-44-34-18-12-29(13-19-34)37(42)11-3-2-9-33(41)10-6-8-31(28-40-24-4-5-25-40)38(43)30-14-20-35(21-15-30)45-26-7-27-46-36-22-16-32(39)17-23-36/h12-23,31,38,43H,2-11,24-28H2,1H3 |
| InChIKey | FJHJHOMHQWYEQW-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.80 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|