C32H46N2O4 — CID 130369429
N-[5-(4-butoxyphenyl)-1-pyrrolidin-1-ylpentan-2-yl]-6-(4-methoxyphenyl)-6-oxohexanamide (PubChem CID 130369429) has the molecular formula C32H46N2O4 and a molecular weight of 522.73 g/mol. Its IUPAC name is N-[5-(4-butoxyphenyl)-1-pyrrolidin-1-ylpentan-2-yl]-6-(4-methoxyphenyl)-6-oxohexanamide.
| Compound Name | N-[5-(4-butoxyphenyl)-1-pyrrolidin-1-ylpentan-2-yl]-6-(4-methoxyphenyl)-6-oxohexanamide |
|---|---|
| PubChem CID | 130369429 |
| Molecular Formula | C32H46N2O4 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | N-[5-(4-butoxyphenyl)-1-pyrrolidin-1-ylpentan-2-yl]-6-(4-methoxyphenyl)-6-oxohexanamide |
| SMILES | CCCCOc1ccc(CCCC(CN2CCCC2)NC(=O)CCCCC(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H46N2O4/c1-3-4-24-38-30-18-14-26(15-19-30)10-9-11-28(25-34-22-7-8-23-34)33-32(36)13-6-5-12-31(35)27-16-20-29(37-2)21-17-27/h14-21,28H,3-13,22-25H2,1-2H3,(H,33,36) |
| InChIKey | BYHZOEZYPZCSOI-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|