C30H43FN2O4 — CID 143865998
1-[3-[4-(4-fluorobutoxy)phenyl]propyl]pyrrolidine;6-(4-methoxyphenyl)-6-oxohexanamide (PubChem CID 143865998) has the molecular formula C30H43FN2O4 and a molecular weight of 514.68 g/mol. Its IUPAC name is 1-[3-[4-(4-fluorobutoxy)phenyl]propyl]pyrrolidine;6-(4-methoxyphenyl)-6-oxohexanamide.
| Compound Name | 1-[3-[4-(4-fluorobutoxy)phenyl]propyl]pyrrolidine;6-(4-methoxyphenyl)-6-oxohexanamide |
|---|---|
| PubChem CID | 143865998 |
| Molecular Formula | C30H43FN2O4 |
| Molecular Weight | 514.68 g/mol |
| Exact Mass | 514.32 |
| IUPAC Name | 1-[3-[4-(4-fluorobutoxy)phenyl]propyl]pyrrolidine;6-(4-methoxyphenyl)-6-oxohexanamide |
| SMILES | COc1ccc(C(=O)CCCCC(N)=O)cc1.FCCCCOc1ccc(CCCN2CCCC2)cc1 |
| InChI | InChI=1S/C17H26FNO.C13H17NO3/c18-11-1-4-15-20-17-9-7-16(8-10-17)6-5-14-19-12-2-3-13-19;1-17-11-8-6-10(7-9-11)12(15)4-2-3-5-13(14)16/h7-10H,1-6,11-15H2;6-9H,2-5H2,1H3,(H2,14,16) |
| InChIKey | DLJDVZAAVYJYSH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.68 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|