C35H43N3O5 — CID 143934806
6-(4-methoxyphenyl)-6-oxohexanamide;4-[2-[4-(3-pyrrolidin-1-ylpropyl)phenoxy]ethoxy]benzonitrile (PubChem CID 143934806) has the molecular formula C35H43N3O5 and a molecular weight of 585.75 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-6-oxohexanamide;4-[2-[4-(3-pyrrolidin-1-ylpropyl)phenoxy]ethoxy]benzonitrile.
| Compound Name | 6-(4-methoxyphenyl)-6-oxohexanamide;4-[2-[4-(3-pyrrolidin-1-ylpropyl)phenoxy]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 143934806 |
| Molecular Formula | C35H43N3O5 |
| Molecular Weight | 585.75 g/mol |
| Exact Mass | 585.32 |
| IUPAC Name | 6-(4-methoxyphenyl)-6-oxohexanamide;4-[2-[4-(3-pyrrolidin-1-ylpropyl)phenoxy]ethoxy]benzonitrile |
| SMILES | COc1ccc(C(=O)CCCCC(N)=O)cc1.N#Cc1ccc(OCCOc2ccc(CCCN3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C22H26N2O2.C13H17NO3/c23-18-20-7-11-22(12-8-20)26-17-16-25-21-9-5-19(6-10-21)4-3-15-24-13-1-2-14-24;1-17-11-8-6-10(7-9-11)12(15)4-2-3-5-13(14)16/h5-12H,1-4,13-17H2;6-9H,2-5H2,1H3,(H2,14,16) |
| InChIKey | PRZNNCZJDKLGLD-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 114.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.75 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|