C33H50N2O5 — CID 143934832
1-[3-(4-hexoxyphenyl)propyl]pyrrolidine;5-[4-(2-methoxyethoxy)phenyl]-5-oxopentanamide (PubChem CID 143934832) has the molecular formula C33H50N2O5 and a molecular weight of 554.77 g/mol. Its IUPAC name is 1-[3-(4-hexoxyphenyl)propyl]pyrrolidine;5-[4-(2-methoxyethoxy)phenyl]-5-oxopentanamide.
| Compound Name | 1-[3-(4-hexoxyphenyl)propyl]pyrrolidine;5-[4-(2-methoxyethoxy)phenyl]-5-oxopentanamide |
|---|---|
| PubChem CID | 143934832 |
| Molecular Formula | C33H50N2O5 |
| Molecular Weight | 554.77 g/mol |
| Exact Mass | 554.37 |
| IUPAC Name | 1-[3-(4-hexoxyphenyl)propyl]pyrrolidine;5-[4-(2-methoxyethoxy)phenyl]-5-oxopentanamide |
| SMILES | CCCCCCOc1ccc(CCCN2CCCC2)cc1.COCCOc1ccc(C(=O)CCCC(N)=O)cc1 |
| InChI | InChI=1S/C19H31NO.C14H19NO4/c1-2-3-4-7-17-21-19-12-10-18(11-13-19)9-8-16-20-14-5-6-15-20;1-18-9-10-19-12-7-5-11(6-8-12)13(16)3-2-4-14(15)17/h10-13H,2-9,14-17H2,1H3;5-8H,2-4,9-10H2,1H3,(H2,15,17) |
| InChIKey | RCWXZMVFVGRHAW-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.77 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|