C29H42N2O5 — CID 70273973
N-[(2S)-1-(4-hexoxyphenyl)-3-[(3S)-3-hydroxypyrrolidin-1-yl]propan-2-yl]-3-(4-methoxyphenoxy)propanamide (PubChem CID 70273973) has the molecular formula C29H42N2O5 and a molecular weight of 498.66 g/mol. Its IUPAC name is N-[(2S)-1-(4-hexoxyphenyl)-3-[(3S)-3-hydroxypyrrolidin-1-yl]propan-2-yl]-3-(4-methoxyphenoxy)propanamide.
| Compound Name | N-[(2S)-1-(4-hexoxyphenyl)-3-[(3S)-3-hydroxypyrrolidin-1-yl]propan-2-yl]-3-(4-methoxyphenoxy)propanamide |
|---|---|
| PubChem CID | 70273973 |
| Molecular Formula | C29H42N2O5 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.31 |
| IUPAC Name | N-[(2S)-1-(4-hexoxyphenyl)-3-[(3S)-3-hydroxypyrrolidin-1-yl]propan-2-yl]-3-(4-methoxyphenoxy)propanamide |
| SMILES | CCCCCCOc1ccc(C[C@@H](CN2CC[C@H](O)C2)NC(=O)CCOc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H42N2O5/c1-3-4-5-6-18-35-27-9-7-23(8-10-27)20-24(21-31-17-15-25(32)22-31)30-29(33)16-19-36-28-13-11-26(34-2)12-14-28/h7-14,24-25,32H,3-6,15-22H2,1-2H3,(H,30,33)/t24-,25-/m0/s1 |
| InChIKey | FDLPAMPBNSGKPN-DQEYMECFSA-N |
| XLogP | 4.22 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|