C30H49FN2O3 — CID 143934700
N-[2-(4-butoxyphenyl)-1-[(3R)-3-fluoropyrrolidin-1-yl]ethyl]-7-ethyl-6-oxododecanamide (PubChem CID 143934700) has the molecular formula C30H49FN2O3 and a molecular weight of 504.73 g/mol. Its IUPAC name is N-[2-(4-butoxyphenyl)-1-[(3R)-3-fluoropyrrolidin-1-yl]ethyl]-7-ethyl-6-oxododecanamide.
| Compound Name | N-[2-(4-butoxyphenyl)-1-[(3R)-3-fluoropyrrolidin-1-yl]ethyl]-7-ethyl-6-oxododecanamide |
|---|---|
| PubChem CID | 143934700 |
| Molecular Formula | C30H49FN2O3 |
| Molecular Weight | 504.73 g/mol |
| Exact Mass | 504.37 |
| IUPAC Name | N-[2-(4-butoxyphenyl)-1-[(3R)-3-fluoropyrrolidin-1-yl]ethyl]-7-ethyl-6-oxododecanamide |
| SMILES | CCCCCC(CC)C(=O)CCCCC(=O)NC(Cc1ccc(OCCCC)cc1)N1CC[C@@H](F)C1 |
| InChI | InChI=1S/C30H49FN2O3/c1-4-7-9-12-25(6-3)28(34)13-10-11-14-30(35)32-29(33-20-19-26(31)23-33)22-24-15-17-27(18-16-24)36-21-8-5-2/h15-18,25-26,29H,4-14,19-23H2,1-3H3,(H,32,35)/t25?,26-,29?/m1/s1 |
| InChIKey | LJIODSBOPAMVIR-QIFBUILRSA-N |
| XLogP | 6.63 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.73 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|