C46H88N4O2 — CID 175579262
N-[1-[4-[1-[[(Z)-octadec-9-enoyl]amino]propyl]piperazin-1-yl]propyl]octadec-9-enamide (PubChem CID 175579262) has the molecular formula C46H88N4O2 and a molecular weight of 729.24 g/mol. Its IUPAC name is N-[1-[4-[1-[[(Z)-octadec-9-enoyl]amino]propyl]piperazin-1-yl]propyl]octadec-9-enamide.
| Compound Name | N-[1-[4-[1-[[(Z)-octadec-9-enoyl]amino]propyl]piperazin-1-yl]propyl]octadec-9-enamide |
|---|---|
| PubChem CID | 175579262 |
| Molecular Formula | C46H88N4O2 |
| Molecular Weight | 729.24 g/mol |
| Exact Mass | 728.69 |
| IUPAC Name | N-[1-[4-[1-[[(Z)-octadec-9-enoyl]amino]propyl]piperazin-1-yl]propyl]octadec-9-enamide |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NC(CC)N1CCN(C(CC)NC(=O)CCCCCCC/C=C\CCCCCCCC)CC1 |
| InChI | InChI=1S/C46H88N4O2/c1-5-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-45(51)47-43(7-3)49-39-41-50(42-40-49)44(8-4)48-46(52)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-6-2/h21-24,43-44H,5-20,25-42H2,1-4H3,(H,47,51)(H,48,52)/b23-21-,24-22? |
| InChIKey | CTCBOBLOZRXWEY-RHSHCKAESA-N |
| XLogP | 12.38 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.24 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|