C26H51N2O3+ — CID 54201231
[1-carboxy-2-(octadec-9-enoylamino)butyl]-trimethylazanium (PubChem CID 54201231) has the molecular formula C26H51N2O3+ and a molecular weight of 439.71 g/mol. Its IUPAC name is [1-carboxy-2-(octadec-9-enoylamino)butyl]-trimethylazanium.
| Compound Name | [1-carboxy-2-(octadec-9-enoylamino)butyl]-trimethylazanium |
|---|---|
| PubChem CID | 54201231 |
| Molecular Formula | C26H51N2O3+ |
| Molecular Weight | 439.71 g/mol |
| Exact Mass | 439.39 |
| IUPAC Name | [1-carboxy-2-(octadec-9-enoylamino)butyl]-trimethylazanium |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NC(CC)C(C(=O)O)[N+](C)(C)C |
| InChI | InChI=1S/C26H50N2O3/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24(29)27-23(7-2)25(26(30)31)28(3,4)5/h14-15,23,25H,6-13,16-22H2,1-5H3,(H-,27,29,30,31)/p+1 |
| InChIKey | PPJYQWLXWLRDDY-UHFFFAOYSA-O |
| XLogP | 6.08 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.71 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|