C21H32N2O3 — CID 70059025
N-[1-[4-(2-morpholin-4-ylethoxy)phenyl]prop-2-enyl]hexanamide (PubChem CID 70059025) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is N-[1-[4-(2-morpholin-4-ylethoxy)phenyl]prop-2-enyl]hexanamide.
| Compound Name | N-[1-[4-(2-morpholin-4-ylethoxy)phenyl]prop-2-enyl]hexanamide |
|---|---|
| PubChem CID | 70059025 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | N-[1-[4-(2-morpholin-4-ylethoxy)phenyl]prop-2-enyl]hexanamide |
| SMILES | C=CC(NC(=O)CCCCC)c1ccc(OCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C21H32N2O3/c1-3-5-6-7-21(24)22-20(4-2)18-8-10-19(11-9-18)26-17-14-23-12-15-25-16-13-23/h4,8-11,20H,2-3,5-7,12-17H2,1H3,(H,22,24) |
| InChIKey | JWGUELWUPAVOMK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|