C27H43FN2O4 — CID 59530657
N-[(1R,2R)-1-(4-butoxyphenyl)-3-[(3R)-3-fluoropyrrolidin-1-yl]-1-hydroxypropan-2-yl]-6-cyclobutyloxyhexanamide (PubChem CID 59530657) has the molecular formula C27H43FN2O4 and a molecular weight of 478.65 g/mol. Its IUPAC name is N-[(1R,2R)-1-(4-butoxyphenyl)-3-[(3R)-3-fluoropyrrolidin-1-yl]-1-hydroxypropan-2-yl]-6-cyclobutyloxyhexanamide.
| Compound Name | N-[(1R,2R)-1-(4-butoxyphenyl)-3-[(3R)-3-fluoropyrrolidin-1-yl]-1-hydroxypropan-2-yl]-6-cyclobutyloxyhexanamide |
|---|---|
| PubChem CID | 59530657 |
| Molecular Formula | C27H43FN2O4 |
| Molecular Weight | 478.65 g/mol |
| Exact Mass | 478.32 |
| IUPAC Name | N-[(1R,2R)-1-(4-butoxyphenyl)-3-[(3R)-3-fluoropyrrolidin-1-yl]-1-hydroxypropan-2-yl]-6-cyclobutyloxyhexanamide |
| SMILES | CCCCOc1ccc([C@@H](O)[C@@H](CN2CC[C@@H](F)C2)NC(=O)CCCCCOC2CCC2)cc1 |
| InChI | InChI=1S/C27H43FN2O4/c1-2-3-17-33-24-13-11-21(12-14-24)27(32)25(20-30-16-15-22(28)19-30)29-26(31)10-5-4-6-18-34-23-8-7-9-23/h11-14,22-23,25,27,32H,2-10,15-20H2,1H3,(H,29,31)/t22-,25-,27-/m1/s1 |
| InChIKey | CYNBHCGMFNNACZ-AVPJRLCVSA-N |
| XLogP | 4.56 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.65 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|