C26H44N3O4P — CID 143934712
N-[(2R)-1-[4-(3-aminopropoxy)phenyl]-1-hydroxy-3-[(3R)-3-phosphanylpyrrolidin-1-yl]propan-2-yl]-6-cyclobutyloxyhexanamide (PubChem CID 143934712) has the molecular formula C26H44N3O4P and a molecular weight of 493.63 g/mol. Its IUPAC name is N-[(2R)-1-[4-(3-aminopropoxy)phenyl]-1-hydroxy-3-[(3R)-3-phosphanylpyrrolidin-1-yl]propan-2-yl]-6-cyclobutyloxyhexanamide.
| Compound Name | N-[(2R)-1-[4-(3-aminopropoxy)phenyl]-1-hydroxy-3-[(3R)-3-phosphanylpyrrolidin-1-yl]propan-2-yl]-6-cyclobutyloxyhexanamide |
|---|---|
| PubChem CID | 143934712 |
| Molecular Formula | C26H44N3O4P |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.31 |
| IUPAC Name | N-[(2R)-1-[4-(3-aminopropoxy)phenyl]-1-hydroxy-3-[(3R)-3-phosphanylpyrrolidin-1-yl]propan-2-yl]-6-cyclobutyloxyhexanamide |
| SMILES | NCCCOc1ccc(C(O)[C@@H](CN2CC[C@@H](P)C2)NC(=O)CCCCCOC2CCC2)cc1 |
| InChI | InChI=1S/C26H44N3O4P/c27-14-5-17-33-22-11-9-20(10-12-22)26(31)24(19-29-15-13-23(34)18-29)28-25(30)8-2-1-3-16-32-21-6-4-7-21/h9-12,21,23-24,26,31H,1-8,13-19,27,34H2,(H,28,30)/t23-,24-,26?/m1/s1 |
| InChIKey | ZISWYEPEUZKZEL-LBHOTPKDSA-N |
| XLogP | 3.01 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|