C26H32ClFN2O4 — CID 143865884
N-[(1R,2R)-1-(4-but-3-en-2-yloxyphenyl)-3-(3-fluoropyrrolidin-1-yl)-1-hydroxypropan-2-yl]-3-(4-chlorophenoxy)propanamide (PubChem CID 143865884) has the molecular formula C26H32ClFN2O4 and a molecular weight of 491.00 g/mol. Its IUPAC name is N-[(1R,2R)-1-(4-but-3-en-2-yloxyphenyl)-3-(3-fluoropyrrolidin-1-yl)-1-hydroxypropan-2-yl]-3-(4-chlorophenoxy)propanamide.
| Compound Name | N-[(1R,2R)-1-(4-but-3-en-2-yloxyphenyl)-3-(3-fluoropyrrolidin-1-yl)-1-hydroxypropan-2-yl]-3-(4-chlorophenoxy)propanamide |
|---|---|
| PubChem CID | 143865884 |
| Molecular Formula | C26H32ClFN2O4 |
| Molecular Weight | 491.00 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | N-[(1R,2R)-1-(4-but-3-en-2-yloxyphenyl)-3-(3-fluoropyrrolidin-1-yl)-1-hydroxypropan-2-yl]-3-(4-chlorophenoxy)propanamide |
| SMILES | C=CC(C)Oc1ccc([C@@H](O)[C@@H](CN2CCC(F)C2)NC(=O)CCOc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H32ClFN2O4/c1-3-18(2)34-23-8-4-19(5-9-23)26(32)24(17-30-14-12-21(28)16-30)29-25(31)13-15-33-22-10-6-20(27)7-11-22/h3-11,18,21,24,26,32H,1,12-17H2,2H3,(H,29,31)/t18?,21?,24-,26-/m1/s1 |
| InChIKey | KHIIAFHQDWEAGB-WKGOYRJPSA-N |
| XLogP | 4.32 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.00 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|