C32H46FNO5 — CID 161199122
(1S,2R)-2-[[(3R)-3-fluoropyrrolidin-1-yl]methyl]-1-hydroxy-8-(oxan-4-yloxy)-1-(4-phenylmethoxyphenyl)octan-4-one;methane (PubChem CID 161199122) has the molecular formula C32H46FNO5 and a molecular weight of 543.72 g/mol. Its IUPAC name is (1S,2R)-2-[[(3R)-3-fluoropyrrolidin-1-yl]methyl]-1-hydroxy-8-(oxan-4-yloxy)-1-(4-phenylmethoxyphenyl)octan-4-one;methane.
| Compound Name | (1S,2R)-2-[[(3R)-3-fluoropyrrolidin-1-yl]methyl]-1-hydroxy-8-(oxan-4-yloxy)-1-(4-phenylmethoxyphenyl)octan-4-one;methane |
|---|---|
| PubChem CID | 161199122 |
| Molecular Formula | C32H46FNO5 |
| Molecular Weight | 543.72 g/mol |
| Exact Mass | 543.34 |
| IUPAC Name | (1S,2R)-2-[[(3R)-3-fluoropyrrolidin-1-yl]methyl]-1-hydroxy-8-(oxan-4-yloxy)-1-(4-phenylmethoxyphenyl)octan-4-one;methane |
| SMILES | C.O=C(CCCCOC1CCOCC1)C[C@H](CN1CC[C@@H](F)C1)[C@H](O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H42FNO5.CH4/c32-27-13-16-33(22-27)21-26(20-28(34)8-4-5-17-37-30-14-18-36-19-15-30)31(35)25-9-11-29(12-10-25)38-23-24-6-2-1-3-7-24;/h1-3,6-7,9-12,26-27,30-31,35H,4-5,8,13-23H2;1H4/t26-,27-,31-;/m1./s1 |
| InChIKey | UUSYOBVXADFVFH-FHVDVPRGSA-N |
| XLogP | 5.92 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.72 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|