C33H46FNO5S — CID 58336082
(1S,2R)-9-cyclohexylsulfonyl-2-[[(3R)-3-fluoropyrrolidin-1-yl]methyl]-1-hydroxy-1-(4-phenylmethoxyphenyl)nonan-4-one (PubChem CID 58336082) has the molecular formula C33H46FNO5S and a molecular weight of 587.80 g/mol. Its IUPAC name is (1S,2R)-9-cyclohexylsulfonyl-2-[[(3R)-3-fluoropyrrolidin-1-yl]methyl]-1-hydroxy-1-(4-phenylmethoxyphenyl)nonan-4-one.
| Compound Name | (1S,2R)-9-cyclohexylsulfonyl-2-[[(3R)-3-fluoropyrrolidin-1-yl]methyl]-1-hydroxy-1-(4-phenylmethoxyphenyl)nonan-4-one |
|---|---|
| PubChem CID | 58336082 |
| Molecular Formula | C33H46FNO5S |
| Molecular Weight | 587.80 g/mol |
| Exact Mass | 587.31 |
| IUPAC Name | (1S,2R)-9-cyclohexylsulfonyl-2-[[(3R)-3-fluoropyrrolidin-1-yl]methyl]-1-hydroxy-1-(4-phenylmethoxyphenyl)nonan-4-one |
| SMILES | O=C(CCCCCS(=O)(=O)C1CCCCC1)C[C@H](CN1CC[C@@H](F)C1)[C@H](O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H46FNO5S/c34-29-19-20-35(24-29)23-28(22-30(36)12-6-3-9-21-41(38,39)32-13-7-2-8-14-32)33(37)27-15-17-31(18-16-27)40-25-26-10-4-1-5-11-26/h1,4-5,10-11,15-18,28-29,32-33,37H,2-3,6-9,12-14,19-25H2/t28-,29-,33-/m1/s1 |
| InChIKey | UUKGMVPYUFJBMF-GOGFDQBKSA-N |
| XLogP | 6.23 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.80 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|