C30H41N2O4+ — CID 91541241
N-[1-(4-butoxyphenyl)-3-pyrrolidin-1-ylpropan-2-yl]-6-(4-methoxyphenyl)-6-oxohexanamide (PubChem CID 91541241) has the molecular formula C30H41N2O4+ and a molecular weight of 493.67 g/mol. Its IUPAC name is N-[1-(4-butoxyphenyl)-3-pyrrolidin-1-ylpropan-2-yl]-6-(4-methoxyphenyl)-6-oxohexanamide.
| Compound Name | N-[1-(4-butoxyphenyl)-3-pyrrolidin-1-ylpropan-2-yl]-6-(4-methoxyphenyl)-6-oxohexanamide |
|---|---|
| PubChem CID | 91541241 |
| Molecular Formula | C30H41N2O4+ |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.31 |
| IUPAC Name | N-[1-(4-butoxyphenyl)-3-pyrrolidin-1-ylpropan-2-yl]-6-(4-methoxyphenyl)-6-oxohexanamide |
| SMILES | [CH2+]CCCOc1ccc(CC(CN2CCCC2)NC(=O)CCCCC(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H40N2O4/c1-3-4-21-36-28-15-11-24(12-16-28)22-26(23-32-19-7-8-20-32)31-30(34)10-6-5-9-29(33)25-13-17-27(35-2)18-14-25/h11-18,26H,1,3-10,19-23H2,2H3/p+1 |
| InChIKey | FUBORDDITGQFDW-UHFFFAOYSA-O |
| XLogP | 5.25 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|