C30H40N2O4S — CID 129295917
N-[1-(2,3-dihydro-1,4-benzoxathiin-6-yl)-3-pyrrolidin-1-ylpropan-2-yl]-8-(4-methoxyphenyl)-8-oxooctanamide (PubChem CID 129295917) has the molecular formula C30H40N2O4S and a molecular weight of 524.73 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1,4-benzoxathiin-6-yl)-3-pyrrolidin-1-ylpropan-2-yl]-8-(4-methoxyphenyl)-8-oxooctanamide.
| Compound Name | N-[1-(2,3-dihydro-1,4-benzoxathiin-6-yl)-3-pyrrolidin-1-ylpropan-2-yl]-8-(4-methoxyphenyl)-8-oxooctanamide |
|---|---|
| PubChem CID | 129295917 |
| Molecular Formula | C30H40N2O4S |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | N-[1-(2,3-dihydro-1,4-benzoxathiin-6-yl)-3-pyrrolidin-1-ylpropan-2-yl]-8-(4-methoxyphenyl)-8-oxooctanamide |
| SMILES | COc1ccc(C(=O)CCCCCCC(=O)NC(Cc2ccc3c(c2)SCCO3)CN2CCCC2)cc1 |
| InChI | InChI=1S/C30H40N2O4S/c1-35-26-13-11-24(12-14-26)27(33)8-4-2-3-5-9-30(34)31-25(22-32-16-6-7-17-32)20-23-10-15-28-29(21-23)37-19-18-36-28/h10-15,21,25H,2-9,16-20,22H2,1H3,(H,31,34) |
| InChIKey | SBBPGPSHMORISC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|