C28H36N2O4 — CID 91094728
N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-pyrrolidin-1-ylpropan-2-yl]-7-oxo-7-phenylheptanamide (PubChem CID 91094728) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-pyrrolidin-1-ylpropan-2-yl]-7-oxo-7-phenylheptanamide.
| Compound Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-pyrrolidin-1-ylpropan-2-yl]-7-oxo-7-phenylheptanamide |
|---|---|
| PubChem CID | 91094728 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-pyrrolidin-1-ylpropan-2-yl]-7-oxo-7-phenylheptanamide |
| SMILES | O=C(CCCCCC(=O)c1ccccc1)NC(Cc1ccc2c(c1)OCCO2)CN1CCCC1 |
| InChI | InChI=1S/C28H36N2O4/c31-25(23-9-3-1-4-10-23)11-5-2-6-12-28(32)29-24(21-30-15-7-8-16-30)19-22-13-14-26-27(20-22)34-18-17-33-26/h1,3-4,9-10,13-14,20,24H,2,5-8,11-12,15-19,21H2,(H,29,32) |
| InChIKey | RQMZSGLAKSMUOE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|