C29H32N2O2 — CID 130369826
N-[2-(4-ethylphenyl)ethyl]-N'-[4-[(E)-2-phenylethenyl]phenyl]pentanediamide (PubChem CID 130369826) has the molecular formula C29H32N2O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is N-[2-(4-ethylphenyl)ethyl]-N'-[4-[(E)-2-phenylethenyl]phenyl]pentanediamide.
| Compound Name | N-[2-(4-ethylphenyl)ethyl]-N'-[4-[(E)-2-phenylethenyl]phenyl]pentanediamide |
|---|---|
| PubChem CID | 130369826 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | N-[2-(4-ethylphenyl)ethyl]-N'-[4-[(E)-2-phenylethenyl]phenyl]pentanediamide |
| SMILES | CCc1ccc(CCNC(=O)CCCC(=O)Nc2ccc(/C=C/c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H32N2O2/c1-2-23-11-13-26(14-12-23)21-22-30-28(32)9-6-10-29(33)31-27-19-17-25(18-20-27)16-15-24-7-4-3-5-8-24/h3-5,7-8,11-20H,2,6,9-10,21-22H2,1H3,(H,30,32)(H,31,33)/b16-15+ |
| InChIKey | HDHIYUHESGMRRN-FOCLMDBBSA-N |
| XLogP | 5.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|