C32H40N2O2 — CID 155014434
N-[2-[4-(2-methylbutan-2-yl)phenyl]ethyl]-N'-[4-(2-phenylethyl)phenyl]pentanediamide (PubChem CID 155014434) has the molecular formula C32H40N2O2 and a molecular weight of 484.68 g/mol. Its IUPAC name is N-[2-[4-(2-methylbutan-2-yl)phenyl]ethyl]-N'-[4-(2-phenylethyl)phenyl]pentanediamide.
| Compound Name | N-[2-[4-(2-methylbutan-2-yl)phenyl]ethyl]-N'-[4-(2-phenylethyl)phenyl]pentanediamide |
|---|---|
| PubChem CID | 155014434 |
| Molecular Formula | C32H40N2O2 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | N-[2-[4-(2-methylbutan-2-yl)phenyl]ethyl]-N'-[4-(2-phenylethyl)phenyl]pentanediamide |
| SMILES | CCC(C)(C)c1ccc(CCNC(=O)CCCC(=O)Nc2ccc(CCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C32H40N2O2/c1-4-32(2,3)28-19-15-27(16-20-28)23-24-33-30(35)11-8-12-31(36)34-29-21-17-26(18-22-29)14-13-25-9-6-5-7-10-25/h5-7,9-10,15-22H,4,8,11-14,23-24H2,1-3H3,(H,33,35)(H,34,36) |
| InChIKey | ULCICBHECNFHFB-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |