C10H10Cl3NOS — CID 13037002
2,2,2-trichloro-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)acetamide (PubChem CID 13037002) has the molecular formula C10H10Cl3NOS and a molecular weight of 298.62 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)acetamide |
|---|---|
| PubChem CID | 13037002 |
| Molecular Formula | C10H10Cl3NOS |
| Molecular Weight | 298.62 g/mol |
| Exact Mass | 296.95 |
| IUPAC Name | 2,2,2-trichloro-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)acetamide |
| SMILES | O=C(NC1CCCc2sccc21)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H10Cl3NOS/c11-10(12,13)9(15)14-7-2-1-3-8-6(7)4-5-16-8/h4-5,7H,1-3H2,(H,14,15) |
| InChIKey | PKJYHHLBOMNKEQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.62 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|