C20H33N — CID 130370964
8-[(1Z)-buta-1,3-dienyl]-11-butyl-3,9-dimethyl-3-azaspiro[5.5]undec-8-ene (PubChem CID 130370964) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is 8-[(1Z)-buta-1,3-dienyl]-11-butyl-3,9-dimethyl-3-azaspiro[5.5]undec-8-ene.
| Compound Name | 8-[(1Z)-buta-1,3-dienyl]-11-butyl-3,9-dimethyl-3-azaspiro[5.5]undec-8-ene |
|---|---|
| PubChem CID | 130370964 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | 8-[(1Z)-buta-1,3-dienyl]-11-butyl-3,9-dimethyl-3-azaspiro[5.5]undec-8-ene |
| SMILES | C=C/C=C\C1=C(C)CC(CCCC)C2(CCN(C)CC2)C1 |
| InChI | InChI=1S/C20H33N/c1-5-7-9-18-16-20(11-13-21(4)14-12-20)19(10-8-6-2)15-17(18)3/h5,7,9,19H,1,6,8,10-16H2,2-4H3/b9-7- |
| InChIKey | ZYEDZNJTGCUFTQ-CLFYSBASSA-N |
| XLogP | 5.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|