C30H52N2 — CID 163003985
(12R,13S,27S,29S)-1,16-diazatetracyclo[25.3.1.112,16.013,29]dotriaconta-8,23-diene (PubChem CID 163003985) has the molecular formula C30H52N2 and a molecular weight of 440.76 g/mol. Its IUPAC name is (12R,13S,27S,29S)-1,16-diazatetracyclo[25.3.1.112,16.013,29]dotriaconta-8,23-diene.
| Compound Name | (12R,13S,27S,29S)-1,16-diazatetracyclo[25.3.1.112,16.013,29]dotriaconta-8,23-diene |
|---|---|
| PubChem CID | 163003985 |
| Molecular Formula | C30H52N2 |
| Molecular Weight | 440.76 g/mol |
| Exact Mass | 440.41 |
| IUPAC Name | (12R,13S,27S,29S)-1,16-diazatetracyclo[25.3.1.112,16.013,29]dotriaconta-8,23-diene |
| SMILES | C1=CCC[C@H]2C[C@@H]3CN(CCCCCCC=CCC[C@H]4CN(CCCCCC1)CC[C@H]34)C2 |
| InChI | InChI=1S/C30H52N2/c1-3-7-11-15-20-31-22-19-30-28(25-31)18-14-10-6-2-4-8-12-16-21-32-24-27(17-13-9-5-1)23-29(30)26-32/h5-6,9-10,27-30H,1-4,7-8,11-26H2/t27-,28-,29+,30-/m0/s1 |
| InChIKey | MEZYUJANHMJTGP-ZXYZSCNASA-N |
| XLogP | 7.46 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.76 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|