C51H44N2 — CID 130371077
2-N'-(5-methylcyclohexa-1,5-dien-1-yl)-7-N'-(3-methylphenyl)-2-N',7-N'-diphenyl-9,9'-spirobi[1,2-dihydrofluorene]-2',7'-diamine (PubChem CID 130371077) has the molecular formula C51H44N2 and a molecular weight of 684.93 g/mol. Its IUPAC name is 2-N'-(5-methylcyclohexa-1,5-dien-1-yl)-7-N'-(3-methylphenyl)-2-N',7-N'-diphenyl-9,9'-spirobi[1,2-dihydrofluorene]-2',7'-diamine.
| Compound Name | 2-N'-(5-methylcyclohexa-1,5-dien-1-yl)-7-N'-(3-methylphenyl)-2-N',7-N'-diphenyl-9,9'-spirobi[1,2-dihydrofluorene]-2',7'-diamine |
|---|---|
| PubChem CID | 130371077 |
| Molecular Formula | C51H44N2 |
| Molecular Weight | 684.93 g/mol |
| Exact Mass | 684.35 |
| IUPAC Name | 2-N'-(5-methylcyclohexa-1,5-dien-1-yl)-7-N'-(3-methylphenyl)-2-N',7-N'-diphenyl-9,9'-spirobi[1,2-dihydrofluorene]-2',7'-diamine |
| SMILES | CC1=CC(N(c2ccccc2)C2C=CC3=C(C2)C2(C4=C(C=CCC4)c4ccccc42)c2cc(N(c4ccccc4)c4cccc(C)c4)ccc23)=CCC1 |
| InChI | InChI=1S/C51H44N2/c1-35-15-13-21-39(31-35)52(37-17-5-3-6-18-37)41-27-29-45-46-30-28-42(53(38-19-7-4-8-20-38)40-22-14-16-36(2)32-40)34-50(46)51(49(45)33-41)47-25-11-9-23-43(47)44-24-10-12-26-48(44)51/h3-11,13,15,17-25,27-33,42H,12,14,16,26,34H2,1-2H3 |
| InChIKey | ZYFDHYZXOHLHBW-UHFFFAOYSA-N |
| XLogP | 13.09 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.93 |
| LogP ≤ 5 | 13.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |