C41H42N2 — CID 163470569
9,9-dimethyl-2-N-(3-methylcyclohexa-1,5-dien-1-yl)-7-N-(5-methylcyclohexa-1,5-dien-1-yl)-2-N,7-N-diphenyl-1,2-dihydrofluorene-2,7-diamine (PubChem CID 163470569) has the molecular formula C41H42N2 and a molecular weight of 562.80 g/mol. Its IUPAC name is 9,9-dimethyl-2-N-(3-methylcyclohexa-1,5-dien-1-yl)-7-N-(5-methylcyclohexa-1,5-dien-1-yl)-2-N,7-N-diphenyl-1,2-dihydrofluorene-2,7-diamine.
| Compound Name | 9,9-dimethyl-2-N-(3-methylcyclohexa-1,5-dien-1-yl)-7-N-(5-methylcyclohexa-1,5-dien-1-yl)-2-N,7-N-diphenyl-1,2-dihydrofluorene-2,7-diamine |
|---|---|
| PubChem CID | 163470569 |
| Molecular Formula | C41H42N2 |
| Molecular Weight | 562.80 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | 9,9-dimethyl-2-N-(3-methylcyclohexa-1,5-dien-1-yl)-7-N-(5-methylcyclohexa-1,5-dien-1-yl)-2-N,7-N-diphenyl-1,2-dihydrofluorene-2,7-diamine |
| SMILES | CC1=CC(N(c2ccccc2)c2ccc3c(c2)C(C)(C)C2=C3C=CC(N(C3=CC(C)CC=C3)c3ccccc3)C2)=CCC1 |
| InChI | InChI=1S/C41H42N2/c1-29-13-11-19-33(25-29)42(31-15-7-5-8-16-31)35-21-23-37-38-24-22-36(28-40(38)41(3,4)39(37)27-35)43(32-17-9-6-10-18-32)34-20-12-14-30(2)26-34/h5-11,15-26,28-29,35H,12-14,27H2,1-4H3 |
| InChIKey | BWFMJHCXFALANK-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.80 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |