C74H62N2 — CID 89189750
9-N-(9,9-dimethyl-1,2-dihydrofluoren-2-yl)-10-N,10-N-bis(9,9-dimethylfluoren-2-yl)-9-N-(9,9-dimethylfluoren-3-yl)anthracene-9,10-diamine (PubChem CID 89189750) has the molecular formula C74H62N2 and a molecular weight of 979.32 g/mol. Its IUPAC name is 9-N-(9,9-dimethyl-1,2-dihydrofluoren-2-yl)-10-N,10-N-bis(9,9-dimethylfluoren-2-yl)-9-N-(9,9-dimethylfluoren-3-yl)anthracene-9,10-diamine.
| Compound Name | 9-N-(9,9-dimethyl-1,2-dihydrofluoren-2-yl)-10-N,10-N-bis(9,9-dimethylfluoren-2-yl)-9-N-(9,9-dimethylfluoren-3-yl)anthracene-9,10-diamine |
|---|---|
| PubChem CID | 89189750 |
| Molecular Formula | C74H62N2 |
| Molecular Weight | 979.32 g/mol |
| Exact Mass | 978.49 |
| IUPAC Name | 9-N-(9,9-dimethyl-1,2-dihydrofluoren-2-yl)-10-N,10-N-bis(9,9-dimethylfluoren-2-yl)-9-N-(9,9-dimethylfluoren-3-yl)anthracene-9,10-diamine |
| SMILES | CC1(C)C2=C(C=CC(N(c3ccc4c(c3)-c3ccccc3C4(C)C)c3c4ccccc4c(N(c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4ccccc34)C2)c2ccccc21 |
| InChI | InChI=1S/C74H62N2/c1-71(2)64-32-20-16-24-52(64)60-41-45(36-40-65(60)71)75(46-33-37-53-49-21-13-17-29-61(49)72(3,4)66(53)42-46)69-56-25-9-11-27-58(56)70(59-28-12-10-26-57(59)69)76(47-34-38-54-50-22-14-18-30-62(50)73(5,6)67(54)43-47)48-35-39-55-51-23-15-19-31-63(51)74(7,8)68(55)44-48/h9-41,43-44,46H,42H2,1-8H3 |
| InChIKey | QBWLZBOEAMDPEO-UHFFFAOYSA-N |
| XLogP | 19.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.32 |
| LogP ≤ 5 | 19.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|