C76H70N2 — CID 89152690
2-N,2-N,7-N-tris(9,9-dimethyl-7,8-dihydrofluoren-2-yl)-7-N-(9,9-dimethylfluoren-2-yl)-9,10-dimethylanthracene-2,7-diamine (PubChem CID 89152690) has the molecular formula C76H70N2 and a molecular weight of 1011.41 g/mol. Its IUPAC name is 2-N,2-N,7-N-tris(9,9-dimethyl-7,8-dihydrofluoren-2-yl)-7-N-(9,9-dimethylfluoren-2-yl)-9,10-dimethylanthracene-2,7-diamine.
| Compound Name | 2-N,2-N,7-N-tris(9,9-dimethyl-7,8-dihydrofluoren-2-yl)-7-N-(9,9-dimethylfluoren-2-yl)-9,10-dimethylanthracene-2,7-diamine |
|---|---|
| PubChem CID | 89152690 |
| Molecular Formula | C76H70N2 |
| Molecular Weight | 1011.41 g/mol |
| Exact Mass | 1010.55 |
| IUPAC Name | 2-N,2-N,7-N-tris(9,9-dimethyl-7,8-dihydrofluoren-2-yl)-7-N-(9,9-dimethylfluoren-2-yl)-9,10-dimethylanthracene-2,7-diamine |
| SMILES | Cc1c2ccc(N(c3ccc4c(c3)C(C)(C)C3=C4C=CCC3)c3ccc4c(c3)C(C)(C)C3=C4C=CCC3)cc2c(C)c2cc(N(c3ccc4c(c3)C(C)(C)C3=C4C=CCC3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)ccc12 |
| InChI | InChI=1S/C76H70N2/c1-45-53-33-27-47(77(49-29-35-59-55-19-11-15-23-65(55)73(3,4)69(59)41-49)50-30-36-60-56-20-12-16-24-66(56)74(5,6)70(60)42-50)39-63(53)46(2)64-40-48(28-34-54(45)64)78(51-31-37-61-57-21-13-17-25-67(57)75(7,8)71(61)43-51)52-32-38-62-58-22-14-18-26-68(58)76(9,10)72(62)44-52/h11-15,19-23,27-44H,16-18,24-26H2,1-10H3 |
| InChIKey | DDMLWTSWHGSHIK-UHFFFAOYSA-N |
| XLogP | 21.04 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1011.41 |
| LogP ≤ 5 | 21.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|