C39H38N2 — CID 70965419
7-N-cyclohexa-1,3-dien-1-yl-2-N-cyclohexa-1,5-dien-1-yl-9,9-dimethyl-2-N,7-N-diphenyl-2,3-dihydrofluorene-2,7-diamine (PubChem CID 70965419) has the molecular formula C39H38N2 and a molecular weight of 534.75 g/mol. Its IUPAC name is 7-N-cyclohexa-1,3-dien-1-yl-2-N-cyclohexa-1,5-dien-1-yl-9,9-dimethyl-2-N,7-N-diphenyl-2,3-dihydrofluorene-2,7-diamine.
| Compound Name | 7-N-cyclohexa-1,3-dien-1-yl-2-N-cyclohexa-1,5-dien-1-yl-9,9-dimethyl-2-N,7-N-diphenyl-2,3-dihydrofluorene-2,7-diamine |
|---|---|
| PubChem CID | 70965419 |
| Molecular Formula | C39H38N2 |
| Molecular Weight | 534.75 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | 7-N-cyclohexa-1,3-dien-1-yl-2-N-cyclohexa-1,5-dien-1-yl-9,9-dimethyl-2-N,7-N-diphenyl-2,3-dihydrofluorene-2,7-diamine |
| SMILES | CC1(C)C2=CC(N(C3=CCCC=C3)c3ccccc3)CC=C2c2ccc(N(C3=CC=CCC3)c3ccccc3)cc21 |
| InChI | InChI=1S/C39H38N2/c1-39(2)37-27-33(40(29-15-7-3-8-16-29)30-17-9-4-10-18-30)23-25-35(37)36-26-24-34(28-38(36)39)41(31-19-11-5-12-20-31)32-21-13-6-14-22-32/h3-5,7-9,11-13,15-17,19-23,25-28,34H,6,10,14,18,24H2,1-2H3 |
| InChIKey | JDMKZLXKHXZUIK-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.75 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |