C47H48N2 — CID 71016274
N-cyclohexa-1,5-dien-1-yl-7-[2-[4-(N-cyclohexa-1,3-dien-1-ylanilino)cyclohexa-1,3-dien-1-yl]ethyl]-9,9-dimethyl-N-phenyl-2,3-dihydrofluoren-2-amine (PubChem CID 71016274) has the molecular formula C47H48N2 and a molecular weight of 640.92 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-7-[2-[4-(N-cyclohexa-1,3-dien-1-ylanilino)cyclohexa-1,3-dien-1-yl]ethyl]-9,9-dimethyl-N-phenyl-2,3-dihydrofluoren-2-amine.
| Compound Name | N-cyclohexa-1,5-dien-1-yl-7-[2-[4-(N-cyclohexa-1,3-dien-1-ylanilino)cyclohexa-1,3-dien-1-yl]ethyl]-9,9-dimethyl-N-phenyl-2,3-dihydrofluoren-2-amine |
|---|---|
| PubChem CID | 71016274 |
| Molecular Formula | C47H48N2 |
| Molecular Weight | 640.92 g/mol |
| Exact Mass | 640.38 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-7-[2-[4-(N-cyclohexa-1,3-dien-1-ylanilino)cyclohexa-1,3-dien-1-yl]ethyl]-9,9-dimethyl-N-phenyl-2,3-dihydrofluoren-2-amine |
| SMILES | CC1(C)C2=CC(N(C3=CCCC=C3)c3ccccc3)CC=C2c2ccc(CCC3=CC=C(N(C4=CC=CCC4)c4ccccc4)CC3)cc21 |
| InChI | InChI=1S/C47H48N2/c1-47(2)45-33-36(24-23-35-25-28-41(29-26-35)48(37-15-7-3-8-16-37)38-17-9-4-10-18-38)27-31-43(45)44-32-30-42(34-46(44)47)49(39-19-11-5-12-20-39)40-21-13-6-14-22-40/h3-5,7-9,11-13,15-17,19-22,25,27-28,31-34,42H,6,10,14,18,23-24,26,29-30H2,1-2H3 |
| InChIKey | WFXLUKJXCHAPGH-UHFFFAOYSA-N |
| XLogP | 12.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.92 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |