C56H50N2 — CID 89178599
7-[(E)-2-[4-[cyclohexa-2,4-dien-1-yl-(9,9-dimethyl-2,3-dihydrofluoren-2-yl)amino]phenyl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine (PubChem CID 89178599) has the molecular formula C56H50N2 and a molecular weight of 751.03 g/mol. Its IUPAC name is 7-[(E)-2-[4-[cyclohexa-2,4-dien-1-yl-(9,9-dimethyl-2,3-dihydrofluoren-2-yl)amino]phenyl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine.
| Compound Name | 7-[(E)-2-[4-[cyclohexa-2,4-dien-1-yl-(9,9-dimethyl-2,3-dihydrofluoren-2-yl)amino]phenyl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine |
|---|---|
| PubChem CID | 89178599 |
| Molecular Formula | C56H50N2 |
| Molecular Weight | 751.03 g/mol |
| Exact Mass | 750.40 |
| IUPAC Name | 7-[(E)-2-[4-[cyclohexa-2,4-dien-1-yl-(9,9-dimethyl-2,3-dihydrofluoren-2-yl)amino]phenyl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine |
| SMILES | CC1(C)C2=CC(N(c3ccc(/C=C/c4ccc5c(c4)C(C)(C)c4cc(N(c6ccccc6)c6ccccc6)ccc4-5)cc3)C3C=CC=CC3)CC=C2c2ccccc21 |
| InChI | InChI=1S/C56H50N2/c1-55(2)51-23-15-14-22-47(51)49-34-31-46(37-53(49)55)58(43-20-12-7-13-21-43)44-29-26-39(27-30-44)24-25-40-28-33-48-50-35-32-45(38-54(50)56(3,4)52(48)36-40)57(41-16-8-5-9-17-41)42-18-10-6-11-19-42/h5-20,22-30,32-38,43,46H,21,31H2,1-4H3/b25-24+ |
| InChIKey | VQQYADFZSLBHDL-OCOZRVBESA-N |
| XLogP | 14.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.03 |
| LogP ≤ 5 | 14.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|