C51H46N2 — CID 167195615
9,9-dimethyl-N-[4-(9-phenyl-1,7,8,9a-tetrahydrocarbazol-3-yl)cyclohexa-2,4-dien-1-yl]-N-(4-phenylphenyl)-7,8-dihydrofluoren-2-amine (PubChem CID 167195615) has the molecular formula C51H46N2 and a molecular weight of 686.94 g/mol. Its IUPAC name is 9,9-dimethyl-N-[4-(9-phenyl-1,7,8,9a-tetrahydrocarbazol-3-yl)cyclohexa-2,4-dien-1-yl]-N-(4-phenylphenyl)-7,8-dihydrofluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-[4-(9-phenyl-1,7,8,9a-tetrahydrocarbazol-3-yl)cyclohexa-2,4-dien-1-yl]-N-(4-phenylphenyl)-7,8-dihydrofluoren-2-amine |
|---|---|
| PubChem CID | 167195615 |
| Molecular Formula | C51H46N2 |
| Molecular Weight | 686.94 g/mol |
| Exact Mass | 686.37 |
| IUPAC Name | 9,9-dimethyl-N-[4-(9-phenyl-1,7,8,9a-tetrahydrocarbazol-3-yl)cyclohexa-2,4-dien-1-yl]-N-(4-phenylphenyl)-7,8-dihydrofluoren-2-amine |
| SMILES | CC1(C)C2=C(C=CCC2)c2ccc(N(c3ccc(-c4ccccc4)cc3)C3C=CC(C4=CCC5C(=C4)C4=C(CCC=C4)N5c4ccccc4)=CC3)cc21 |
| InChI | InChI=1S/C51H46N2/c1-51(2)47-19-11-9-17-43(47)44-31-30-42(34-48(44)51)52(40-26-21-36(22-27-40)35-13-5-3-6-14-35)41-28-23-37(24-29-41)38-25-32-50-46(33-38)45-18-10-12-20-49(45)53(50)39-15-7-4-8-16-39/h3-10,13-18,21-28,30-31,33-34,41,50H,11-12,19-20,29,32H2,1-2H3 |
| InChIKey | PJWXUPFBGZWNPU-UHFFFAOYSA-N |
| XLogP | 12.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.94 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |