About CID 89095746
CID 89095746 (PubChem CID 89095746) has the molecular formula C36H29BN2
and a molecular weight of 500.45 g/mol.
Molecular Properties
| Compound Name | CID 89095746 |
| PubChem CID | 89095746 |
| Molecular Formula | C36H29BN2 |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(N2c3ccccc3C3C=C(C4=CCC5C(=C4)C4=C(CCC=C4)N5c4ccccc4)C=CC32)cc1 |
| InChI | InChI=1S/C36H29BN2/c37-26-16-18-28(19-17-26)39-34-13-7-5-11-30(34)32-23-25(15-21-36(32)39)24-14-20-35-31(22-24)29-10-4-6-12-33(29)38(35)27-8-2-1-3-9-27/h1-5,7-11,13-19,21-23,32,35-36H,6,12,20H2 |
| InChIKey | YAWDLHIPUFNUTF-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89095746 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89095746?
The IUPAC name of CID 89095746 (CID 89095746) is not available.
What is the SMILES notation for CID 89095746?
The canonical SMILES for CID 89095746 is [B]c1ccc(N2c3ccccc3C3C=C(C4=CCC5C(=C4)C4=C(CCC=C4)N5c4ccccc4)C=CC32)cc1.
What is the InChIKey of CID 89095746?
The InChIKey is YAWDLHIPUFNUTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H29BN2/c37-26-16-18-28(19-17-26)39-34-13-7-5-11-30(34)32-23-25(15-21-36(32)39)24-14-20-35-31(22-24)29-10-4-6-12-33(29)38(35)27-8-2-1-3-9-27/h1-5,7-11,13-19,21-23,32,35-36H,6,12,20H2.
What are the key properties of CID 89095746?
CID 89095746 has a molecular weight of 500.45 g/mol, XLogP of 7.33, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89095746 is sourced from PubChem (CID 89095746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).