C36H29BN2 — CID 89095746
CID 89095746 (PubChem CID 89095746) has the molecular formula C36H29BN2 and a molecular weight of 500.45 g/mol.
| Compound Name | CID 89095746 |
|---|---|
| PubChem CID | 89095746 |
| Molecular Formula | C36H29BN2 |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(N2c3ccccc3C3C=C(C4=CCC5C(=C4)C4=C(CCC=C4)N5c4ccccc4)C=CC32)cc1 |
| InChI | InChI=1S/C36H29BN2/c37-26-16-18-28(19-17-26)39-34-13-7-5-11-30(34)32-23-25(15-21-36(32)39)24-14-20-35-31(22-24)29-10-4-6-12-33(29)38(35)27-8-2-1-3-9-27/h1-5,7-11,13-19,21-23,32,35-36H,6,12,20H2 |
| InChIKey | YAWDLHIPUFNUTF-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|