C28H27NO — CID 89067073
7-(N-cyclohexa-1,5-dien-1-ylanilino)-9,9-dimethyl-3,4-dihydrofluorene-2-carbaldehyde (PubChem CID 89067073) has the molecular formula C28H27NO and a molecular weight of 393.53 g/mol. Its IUPAC name is 7-(N-cyclohexa-1,5-dien-1-ylanilino)-9,9-dimethyl-3,4-dihydrofluorene-2-carbaldehyde.
| Compound Name | 7-(N-cyclohexa-1,5-dien-1-ylanilino)-9,9-dimethyl-3,4-dihydrofluorene-2-carbaldehyde |
|---|---|
| PubChem CID | 89067073 |
| Molecular Formula | C28H27NO |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 7-(N-cyclohexa-1,5-dien-1-ylanilino)-9,9-dimethyl-3,4-dihydrofluorene-2-carbaldehyde |
| SMILES | CC1(C)C2=C(CCC(C=O)=C2)c2ccc(N(C3=CCCC=C3)c3ccccc3)cc21 |
| InChI | InChI=1S/C28H27NO/c1-28(2)26-17-20(19-30)13-15-24(26)25-16-14-23(18-27(25)28)29(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3,5-7,9-12,14,16-19H,4,8,13,15H2,1-2H3 |
| InChIKey | PYVWIGDMGUEOGE-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|