C56H56N2 — CID 144734094
N-[4-[4-[cyclohexa-1,5-dien-1-yl-(9,9-dimethyl-5,6-dihydrofluoren-2-yl)amino]phenyl]phenyl]-8,8,14-trimethyl-N-phenyltricyclo[7.4.1.02,7]tetradeca-2(7),3,5,10-tetraen-5-amine (PubChem CID 144734094) has the molecular formula C56H56N2 and a molecular weight of 757.08 g/mol. Its IUPAC name is N-[4-[4-[cyclohexa-1,5-dien-1-yl-(9,9-dimethyl-5,6-dihydrofluoren-2-yl)amino]phenyl]phenyl]-8,8,14-trimethyl-N-phenyltricyclo[7.4.1.02,7]tetradeca-2(7),3,5,10-tetraen-5-amine.
| Compound Name | N-[4-[4-[cyclohexa-1,5-dien-1-yl-(9,9-dimethyl-5,6-dihydrofluoren-2-yl)amino]phenyl]phenyl]-8,8,14-trimethyl-N-phenyltricyclo[7.4.1.02,7]tetradeca-2(7),3,5,10-tetraen-5-amine |
|---|---|
| PubChem CID | 144734094 |
| Molecular Formula | C56H56N2 |
| Molecular Weight | 757.08 g/mol |
| Exact Mass | 756.44 |
| IUPAC Name | N-[4-[4-[cyclohexa-1,5-dien-1-yl-(9,9-dimethyl-5,6-dihydrofluoren-2-yl)amino]phenyl]phenyl]-8,8,14-trimethyl-N-phenyltricyclo[7.4.1.02,7]tetradeca-2(7),3,5,10-tetraen-5-amine |
| SMILES | CC1C2CCC=CC1C(C)(C)c1cc(N(c3ccccc3)c3ccc(-c4ccc(N(C5=CCCC=C5)c5ccc6c(c5)C(C)(C)C5=C6CCC=C5)cc4)cc3)ccc12 |
| InChI | InChI=1S/C56H56N2/c1-38-47-20-12-14-22-51(38)55(2,3)53-36-45(32-34-49(47)53)57(41-16-8-6-9-17-41)43-28-24-39(25-29-43)40-26-30-44(31-27-40)58(42-18-10-7-11-19-42)46-33-35-50-48-21-13-15-23-52(48)56(4,5)54(50)37-46/h6,8-10,14-19,22-38,47,51H,7,11-13,20-21H2,1-5H3 |
| InChIKey | GFLZLKJIRNRZEE-UHFFFAOYSA-N |
| XLogP | 15.57 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.08 |
| LogP ≤ 5 | 15.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|