C51H45N3S — CID 163867785
N-cyclohexa-1,5-dien-1-yl-N-(9,9-dimethylfluoren-2-yl)-9-[(3E)-4-phenothiazin-10-ylhexa-1,3-dien-2-yl]-1,2-dihydrocarbazol-4-amine (PubChem CID 163867785) has the molecular formula C51H45N3S and a molecular weight of 732.01 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-N-(9,9-dimethylfluoren-2-yl)-9-[(3E)-4-phenothiazin-10-ylhexa-1,3-dien-2-yl]-1,2-dihydrocarbazol-4-amine.
| Compound Name | N-cyclohexa-1,5-dien-1-yl-N-(9,9-dimethylfluoren-2-yl)-9-[(3E)-4-phenothiazin-10-ylhexa-1,3-dien-2-yl]-1,2-dihydrocarbazol-4-amine |
|---|---|
| PubChem CID | 163867785 |
| Molecular Formula | C51H45N3S |
| Molecular Weight | 732.01 g/mol |
| Exact Mass | 731.33 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-N-(9,9-dimethylfluoren-2-yl)-9-[(3E)-4-phenothiazin-10-ylhexa-1,3-dien-2-yl]-1,2-dihydrocarbazol-4-amine |
| SMILES | C=C(/C=C(\CC)N1c2ccccc2Sc2ccccc21)n1c2c(c3ccccc31)C(N(C1=CCCC=C1)c1ccc3c(c1)C(C)(C)c1ccccc1-3)=CCC2 |
| InChI | InChI=1S/C51H45N3S/c1-5-35(54-44-24-13-15-28-48(44)55-49-29-16-14-25-45(49)54)32-34(2)52-43-23-12-10-21-40(43)50-46(52)26-17-27-47(50)53(36-18-7-6-8-19-36)37-30-31-39-38-20-9-11-22-41(38)51(3,4)42(39)33-37/h7,9-16,18-25,27-33H,2,5-6,8,17,26H2,1,3-4H3/b35-32+ |
| InChIKey | PIDRJTIFJVUZMR-LVYIWIAJSA-N |
| XLogP | 14.04 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.01 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|