C15H13F3N2O3 — CID 13037178
5-hydroxy-N-(pyridin-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 13037178) has the molecular formula C15H13F3N2O3 and a molecular weight of 326.27 g/mol. Its IUPAC name is 5-hydroxy-N-(pyridin-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | 5-hydroxy-N-(pyridin-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 13037178 |
| Molecular Formula | C15H13F3N2O3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 5-hydroxy-N-(pyridin-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | O=C(NCc1ccccn1)c1cc(O)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C15H13F3N2O3/c16-15(17,18)9-23-13-5-4-11(21)7-12(13)14(22)20-8-10-3-1-2-6-19-10/h1-7,21H,8-9H2,(H,20,22) |
| InChIKey | MFBPSJGIVGOCMN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |